C14H15Cl3O2 — CID 83925208
methyl 2-[2-(2,3,6-trichlorophenyl)propyl]cyclopropane-1-carboxylate (PubChem CID 83925208) has the molecular formula C14H15Cl3O2 and a molecular weight of 321.63 g/mol. Its IUPAC name is methyl 2-[2-(2,3,6-trichlorophenyl)propyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 2-[2-(2,3,6-trichlorophenyl)propyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 83925208 |
| Molecular Formula | C14H15Cl3O2 |
| Molecular Weight | 321.63 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | methyl 2-[2-(2,3,6-trichlorophenyl)propyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1CC1CC(C)c1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C14H15Cl3O2/c1-7(5-8-6-9(8)14(18)19-2)12-10(15)3-4-11(16)13(12)17/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | LBYNXBUDCYNTLX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|