C17H24O4S — CID 83927024
methyl 2-[2-(3-propan-2-ylsulfonylphenyl)propyl]cyclopropane-1-carboxylate (PubChem CID 83927024) has the molecular formula C17H24O4S and a molecular weight of 324.44 g/mol. Its IUPAC name is methyl 2-[2-(3-propan-2-ylsulfonylphenyl)propyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 2-[2-(3-propan-2-ylsulfonylphenyl)propyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 83927024 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | methyl 2-[2-(3-propan-2-ylsulfonylphenyl)propyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1CC1CC(C)c1cccc(S(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C17H24O4S/c1-11(2)22(19,20)15-7-5-6-13(9-15)12(3)8-14-10-16(14)17(18)21-4/h5-7,9,11-12,14,16H,8,10H2,1-4H3 |
| InChIKey | VUNYVKQWGLLTFF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |