C14H23NO — CID 83922878
2-(6-aminoheptan-3-yl)-4-methylphenol (PubChem CID 83922878) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-(6-aminoheptan-3-yl)-4-methylphenol.
| Compound Name | 2-(6-aminoheptan-3-yl)-4-methylphenol |
|---|---|
| PubChem CID | 83922878 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-(6-aminoheptan-3-yl)-4-methylphenol |
| SMILES | CCC(CCC(C)N)c1cc(C)ccc1O |
| InChI | InChI=1S/C14H23NO/c1-4-12(7-6-11(3)15)13-9-10(2)5-8-14(13)16/h5,8-9,11-12,16H,4,6-7,15H2,1-3H3 |
| InChIKey | RDVFZUFCZOYDPR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |