C11H15Cl2NO2 — CID 83928675
1-amino-4-(3,5-dichloro-4-methoxyphenyl)butan-2-ol (PubChem CID 83928675) has the molecular formula C11H15Cl2NO2 and a molecular weight of 264.15 g/mol. Its IUPAC name is 1-amino-4-(3,5-dichloro-4-methoxyphenyl)butan-2-ol.
| Compound Name | 1-amino-4-(3,5-dichloro-4-methoxyphenyl)butan-2-ol |
|---|---|
| PubChem CID | 83928675 |
| Molecular Formula | C11H15Cl2NO2 |
| Molecular Weight | 264.15 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-amino-4-(3,5-dichloro-4-methoxyphenyl)butan-2-ol |
| SMILES | COc1c(Cl)cc(CCC(O)CN)cc1Cl |
| InChI | InChI=1S/C11H15Cl2NO2/c1-16-11-9(12)4-7(5-10(11)13)2-3-8(15)6-14/h4-5,8,15H,2-3,6,14H2,1H3 |
| InChIKey | SAPKIFKYRMGVMG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.15 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |