C12H16Cl2O3 — CID 83928638
2-[2-(3,5-dichloro-4-methoxyphenyl)ethyl]propane-1,3-diol (PubChem CID 83928638) has the molecular formula C12H16Cl2O3 and a molecular weight of 279.16 g/mol. Its IUPAC name is 2-[2-(3,5-dichloro-4-methoxyphenyl)ethyl]propane-1,3-diol.
| Compound Name | 2-[2-(3,5-dichloro-4-methoxyphenyl)ethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 83928638 |
| Molecular Formula | C12H16Cl2O3 |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[2-(3,5-dichloro-4-methoxyphenyl)ethyl]propane-1,3-diol |
| SMILES | COc1c(Cl)cc(CCC(CO)CO)cc1Cl |
| InChI | InChI=1S/C12H16Cl2O3/c1-17-12-10(13)4-8(5-11(12)14)2-3-9(6-15)7-16/h4-5,9,15-16H,2-3,6-7H2,1H3 |
| InChIKey | VRNLARZLVLDLLH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |