C10H14Cl2FNO2 — CID 170893643
2-amino-3-(3-chloro-5-fluoro-4-methoxyphenyl)propan-1-ol;hydrochloride (PubChem CID 170893643) has the molecular formula C10H14Cl2FNO2 and a molecular weight of 270.13 g/mol. Its IUPAC name is 2-amino-3-(3-chloro-5-fluoro-4-methoxyphenyl)propan-1-ol;hydrochloride.
| Compound Name | 2-amino-3-(3-chloro-5-fluoro-4-methoxyphenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170893643 |
| Molecular Formula | C10H14Cl2FNO2 |
| Molecular Weight | 270.13 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 2-amino-3-(3-chloro-5-fluoro-4-methoxyphenyl)propan-1-ol;hydrochloride |
| SMILES | COc1c(F)cc(CC(N)CO)cc1Cl.Cl |
| InChI | InChI=1S/C10H13ClFNO2.ClH/c1-15-10-8(11)3-6(4-9(10)12)2-7(13)5-14;/h3-4,7,14H,2,5,13H2,1H3;1H |
| InChIKey | DAEGIIZMIXNDIB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.13 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |