C11H17FN2 — CID 83930930
2-[1-(4-fluorophenyl)ethyl]propane-1,3-diamine (PubChem CID 83930930) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)ethyl]propane-1,3-diamine.
| Compound Name | 2-[1-(4-fluorophenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 83930930 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 2-[1-(4-fluorophenyl)ethyl]propane-1,3-diamine |
| SMILES | CC(c1ccc(F)cc1)C(CN)CN |
| InChI | InChI=1S/C11H17FN2/c1-8(10(6-13)7-14)9-2-4-11(12)5-3-9/h2-5,8,10H,6-7,13-14H2,1H3 |
| InChIKey | OPHDFGXKAHOJIM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |