C16H23ClN2O — CID 83931484
4-(2-chloro-4,5-dimethylphenyl)-1-piperazin-1-ylbutan-1-one (PubChem CID 83931484) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is 4-(2-chloro-4,5-dimethylphenyl)-1-piperazin-1-ylbutan-1-one.
| Compound Name | 4-(2-chloro-4,5-dimethylphenyl)-1-piperazin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 83931484 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-(2-chloro-4,5-dimethylphenyl)-1-piperazin-1-ylbutan-1-one |
| SMILES | Cc1cc(Cl)c(CCCC(=O)N2CCNCC2)cc1C |
| InChI | InChI=1S/C16H23ClN2O/c1-12-10-14(15(17)11-13(12)2)4-3-5-16(20)19-8-6-18-7-9-19/h10-11,18H,3-9H2,1-2H3 |
| InChIKey | ZHPMCHUHQVEUOC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |