C18H28O2 — CID 83932033
4-hex-5-en-3-yl-1,2-dipropoxybenzene (PubChem CID 83932033) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 4-hex-5-en-3-yl-1,2-dipropoxybenzene.
| Compound Name | 4-hex-5-en-3-yl-1,2-dipropoxybenzene |
|---|---|
| PubChem CID | 83932033 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 4-hex-5-en-3-yl-1,2-dipropoxybenzene |
| SMILES | C=CCC(CC)c1ccc(OCCC)c(OCCC)c1 |
| InChI | InChI=1S/C18H28O2/c1-5-9-15(8-4)16-10-11-17(19-12-6-2)18(14-16)20-13-7-3/h5,10-11,14-15H,1,6-9,12-13H2,2-4H3 |
| InChIKey | ZUDKRHCJSUWGPP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|