About 2-hex-5-yn-3-ylthiophene
2-hex-5-yn-3-ylthiophene (PubChem CID 83934801) has the molecular formula C10H12S
and a molecular weight of 164.27 g/mol. Its IUPAC name is 2-hex-5-yn-3-ylthiophene.
Molecular Properties
| Compound Name | 2-hex-5-yn-3-ylthiophene |
| PubChem CID | 83934801 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 2-hex-5-yn-3-ylthiophene |
| SMILES | C#CCC(CC)c1cccs1 |
| InChI | InChI=1S/C10H12S/c1-3-6-9(4-2)10-7-5-8-11-10/h1,5,7-9H,4,6H2,2H3 |
| InChIKey | VDMOFKRKGFMAHV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hex-5-yn-3-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-5-yn-3-ylthiophene?
The IUPAC name of 2-hex-5-yn-3-ylthiophene (CID 83934801) is 2-hex-5-yn-3-ylthiophene.
What is the SMILES notation for 2-hex-5-yn-3-ylthiophene?
The canonical SMILES for 2-hex-5-yn-3-ylthiophene is C#CCC(CC)c1cccs1.
What is the InChIKey of 2-hex-5-yn-3-ylthiophene?
The InChIKey is VDMOFKRKGFMAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12S/c1-3-6-9(4-2)10-7-5-8-11-10/h1,5,7-9H,4,6H2,2H3.
What are the key properties of 2-hex-5-yn-3-ylthiophene?
2-hex-5-yn-3-ylthiophene has a molecular weight of 164.27 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-5-yn-3-ylthiophene is sourced from PubChem (CID 83934801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).