About 3-thiophen-2-ylpentanal
3-thiophen-2-ylpentanal (PubChem CID 83827070) has the molecular formula C9H12OS
and a molecular weight of 168.26 g/mol. Its IUPAC name is 3-thiophen-2-ylpentanal.
Molecular Properties
| Compound Name | 3-thiophen-2-ylpentanal |
| PubChem CID | 83827070 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 3-thiophen-2-ylpentanal |
| SMILES | CCC(CC=O)c1cccs1 |
| InChI | InChI=1S/C9H12OS/c1-2-8(5-6-10)9-4-3-7-11-9/h3-4,6-8H,2,5H2,1H3 |
| InChIKey | ZOQJDMGDOHGZRN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-thiophen-2-ylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-ylpentanal?
The IUPAC name of 3-thiophen-2-ylpentanal (CID 83827070) is 3-thiophen-2-ylpentanal.
What is the SMILES notation for 3-thiophen-2-ylpentanal?
The canonical SMILES for 3-thiophen-2-ylpentanal is CCC(CC=O)c1cccs1.
What is the InChIKey of 3-thiophen-2-ylpentanal?
The InChIKey is ZOQJDMGDOHGZRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12OS/c1-2-8(5-6-10)9-4-3-7-11-9/h3-4,6-8H,2,5H2,1H3.
What are the key properties of 3-thiophen-2-ylpentanal?
3-thiophen-2-ylpentanal has a molecular weight of 168.26 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-ylpentanal is sourced from PubChem (CID 83827070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).