C17H26O2 — CID 83937057
2-methyl-3-[1-[2-methyl-4-(2-methylpropoxy)phenyl]propan-2-yl]oxirane (PubChem CID 83937057) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 2-methyl-3-[1-[2-methyl-4-(2-methylpropoxy)phenyl]propan-2-yl]oxirane.
| Compound Name | 2-methyl-3-[1-[2-methyl-4-(2-methylpropoxy)phenyl]propan-2-yl]oxirane |
|---|---|
| PubChem CID | 83937057 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 2-methyl-3-[1-[2-methyl-4-(2-methylpropoxy)phenyl]propan-2-yl]oxirane |
| SMILES | Cc1cc(OCC(C)C)ccc1CC(C)C1OC1C |
| InChI | InChI=1S/C17H26O2/c1-11(2)10-18-16-7-6-15(12(3)9-16)8-13(4)17-14(5)19-17/h6-7,9,11,13-14,17H,8,10H2,1-5H3 |
| InChIKey | FQFHWKHTBZPTEA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|