C10H11ClF2O — CID 87426607
1-(chloromethyl)-4-(2,2-difluoroethoxy)-2-methylbenzene (PubChem CID 87426607) has the molecular formula C10H11ClF2O and a molecular weight of 220.65 g/mol. Its IUPAC name is 1-(chloromethyl)-4-(2,2-difluoroethoxy)-2-methylbenzene.
| Compound Name | 1-(chloromethyl)-4-(2,2-difluoroethoxy)-2-methylbenzene |
|---|---|
| PubChem CID | 87426607 |
| Molecular Formula | C10H11ClF2O |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 1-(chloromethyl)-4-(2,2-difluoroethoxy)-2-methylbenzene |
| SMILES | Cc1cc(OCC(F)F)ccc1CCl |
| InChI | InChI=1S/C10H11ClF2O/c1-7-4-9(14-6-10(12)13)3-2-8(7)5-11/h2-4,10H,5-6H2,1H3 |
| InChIKey | XWNRTRXFALBIRE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|