C9H9F4NO — CID 155818639
4-(2,2-difluoroethoxy)-2-(difluoromethyl)aniline (PubChem CID 155818639) has the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-2-(difluoromethyl)aniline.
| Compound Name | 4-(2,2-difluoroethoxy)-2-(difluoromethyl)aniline |
|---|---|
| PubChem CID | 155818639 |
| Molecular Formula | C9H9F4NO |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-2-(difluoromethyl)aniline |
| SMILES | Nc1ccc(OCC(F)F)cc1C(F)F |
| InChI | InChI=1S/C9H9F4NO/c10-8(11)4-15-5-1-2-7(14)6(3-5)9(12)13/h1-3,8-9H,4,14H2 |
| InChIKey | NXIJSCMLPNQPJF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|