C14H18O — CID 83939698
1-methoxy-2,3-dimethyl-4-pent-4-yn-2-ylbenzene (PubChem CID 83939698) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-methoxy-2,3-dimethyl-4-pent-4-yn-2-ylbenzene.
| Compound Name | 1-methoxy-2,3-dimethyl-4-pent-4-yn-2-ylbenzene |
|---|---|
| PubChem CID | 83939698 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-methoxy-2,3-dimethyl-4-pent-4-yn-2-ylbenzene |
| SMILES | C#CCC(C)c1ccc(OC)c(C)c1C |
| InChI | InChI=1S/C14H18O/c1-6-7-10(2)13-8-9-14(15-5)12(4)11(13)3/h1,8-10H,7H2,2-5H3 |
| InChIKey | OSHICNUGHOKPAJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|