C17H28O3 — CID 83941886
5-(2-ethyl-4-propoxyphenyl)hexane-2,3-diol (PubChem CID 83941886) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is 5-(2-ethyl-4-propoxyphenyl)hexane-2,3-diol.
| Compound Name | 5-(2-ethyl-4-propoxyphenyl)hexane-2,3-diol |
|---|---|
| PubChem CID | 83941886 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 5-(2-ethyl-4-propoxyphenyl)hexane-2,3-diol |
| SMILES | CCCOc1ccc(C(C)CC(O)C(C)O)c(CC)c1 |
| InChI | InChI=1S/C17H28O3/c1-5-9-20-15-7-8-16(14(6-2)11-15)12(3)10-17(19)13(4)18/h7-8,11-13,17-19H,5-6,9-10H2,1-4H3 |
| InChIKey | AAKZQSLEGLKKAR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |