C14H24N2O — CID 83942546
2-[(2-ethoxy-5-ethylphenyl)methyl]propane-1,3-diamine (PubChem CID 83942546) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-[(2-ethoxy-5-ethylphenyl)methyl]propane-1,3-diamine.
| Compound Name | 2-[(2-ethoxy-5-ethylphenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 83942546 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-[(2-ethoxy-5-ethylphenyl)methyl]propane-1,3-diamine |
| SMILES | CCOc1ccc(CC)cc1CC(CN)CN |
| InChI | InChI=1S/C14H24N2O/c1-3-11-5-6-14(17-4-2)13(7-11)8-12(9-15)10-16/h5-7,12H,3-4,8-10,15-16H2,1-2H3 |
| InChIKey | MHLBWDIVSXENCK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |