C18H27NO3 — CID 83944727
1-(1-butyl-5,6-diethoxyindol-3-yl)ethanol (PubChem CID 83944727) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 1-(1-butyl-5,6-diethoxyindol-3-yl)ethanol.
| Compound Name | 1-(1-butyl-5,6-diethoxyindol-3-yl)ethanol |
|---|---|
| PubChem CID | 83944727 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 1-(1-butyl-5,6-diethoxyindol-3-yl)ethanol |
| SMILES | CCCCn1cc(C(C)O)c2cc(OCC)c(OCC)cc21 |
| InChI | InChI=1S/C18H27NO3/c1-5-8-9-19-12-15(13(4)20)14-10-17(21-6-2)18(22-7-3)11-16(14)19/h10-13,20H,5-9H2,1-4H3 |
| InChIKey | KRWBXJBKNLWLCZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |