C18H28N2O2 — CID 83948446
2-(1-butyl-5,6-diethoxyindol-3-yl)ethanamine (PubChem CID 83948446) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-(1-butyl-5,6-diethoxyindol-3-yl)ethanamine.
| Compound Name | 2-(1-butyl-5,6-diethoxyindol-3-yl)ethanamine |
|---|---|
| PubChem CID | 83948446 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-(1-butyl-5,6-diethoxyindol-3-yl)ethanamine |
| SMILES | CCCCn1cc(CCN)c2cc(OCC)c(OCC)cc21 |
| InChI | InChI=1S/C18H28N2O2/c1-4-7-10-20-13-14(8-9-19)15-11-17(21-5-2)18(22-6-3)12-16(15)20/h11-13H,4-10,19H2,1-3H3 |
| InChIKey | QNPLFVCHZWMKGN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |