C15H22N2O3 — CID 83944570
2-[3-(3-aminopropyl)-5,6-dimethoxyindol-1-yl]ethanol (PubChem CID 83944570) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[3-(3-aminopropyl)-5,6-dimethoxyindol-1-yl]ethanol.
| Compound Name | 2-[3-(3-aminopropyl)-5,6-dimethoxyindol-1-yl]ethanol |
|---|---|
| PubChem CID | 83944570 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-[3-(3-aminopropyl)-5,6-dimethoxyindol-1-yl]ethanol |
| SMILES | COc1cc2c(CCCN)cn(CCO)c2cc1OC |
| InChI | InChI=1S/C15H22N2O3/c1-19-14-8-12-11(4-3-5-16)10-17(6-7-18)13(12)9-15(14)20-2/h8-10,18H,3-7,16H2,1-2H3 |
| InChIKey | WSKOOOCEOMSNSK-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |