C17H24N2O4 — CID 83944715
2-[3-(3-aminopropyl)-5,6-diethoxyindol-1-yl]acetic acid (PubChem CID 83944715) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-[3-(3-aminopropyl)-5,6-diethoxyindol-1-yl]acetic acid.
| Compound Name | 2-[3-(3-aminopropyl)-5,6-diethoxyindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 83944715 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[3-(3-aminopropyl)-5,6-diethoxyindol-1-yl]acetic acid |
| SMILES | CCOc1cc2c(CCCN)cn(CC(=O)O)c2cc1OCC |
| InChI | InChI=1S/C17H24N2O4/c1-3-22-15-8-13-12(6-5-7-18)10-19(11-17(20)21)14(13)9-16(15)23-4-2/h8-10H,3-7,11,18H2,1-2H3,(H,20,21) |
| InChIKey | OWYRZXPJKHOAMA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |