About 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine
3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine (PubChem CID 83948403) has the molecular formula C16H25N3O2
and a molecular weight of 291.40 g/mol. Its IUPAC name is 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine |
| PubChem CID | 83948403 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine |
| SMILES | COc1cc2c(CCCN)cn(CCCN)c2cc1OC |
| InChI | InChI=1S/C16H25N3O2/c1-20-15-9-13-12(5-3-6-17)11-19(8-4-7-18)14(13)10-16(15)21-2/h9-11H,3-8,17-18H2,1-2H3 |
| InChIKey | MCAQPALLJCZGSM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine?
The IUPAC name of 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine (CID 83948403) is 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine.
What is the SMILES notation for 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine?
The canonical SMILES for 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine is COc1cc2c(CCCN)cn(CCCN)c2cc1OC.
What is the InChIKey of 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine?
The InChIKey is MCAQPALLJCZGSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2/c1-20-15-9-13-12(5-3-6-17)11-19(8-4-7-18)14(13)10-16(15)21-2/h9-11H,3-8,17-18H2,1-2H3.
What are the key properties of 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine?
3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine has a molecular weight of 291.40 g/mol, XLogP of 1.90, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3-aminopropyl)-5,6-dimethoxyindol-3-yl]propan-1-amine is sourced from PubChem (CID 83948403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).