C15H22N2 — CID 83948289
3-(3-ethyl-5,6-dimethylindol-1-yl)propan-1-amine (PubChem CID 83948289) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(3-ethyl-5,6-dimethylindol-1-yl)propan-1-amine.
| Compound Name | 3-(3-ethyl-5,6-dimethylindol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 83948289 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-(3-ethyl-5,6-dimethylindol-1-yl)propan-1-amine |
| SMILES | CCc1cn(CCCN)c2cc(C)c(C)cc12 |
| InChI | InChI=1S/C15H22N2/c1-4-13-10-17(7-5-6-16)15-9-12(3)11(2)8-14(13)15/h8-10H,4-7,16H2,1-3H3 |
| InChIKey | GCTXXZKMBBFSNC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |