C15H22N2 — CID 83948751
3-(3,5-diethylindol-1-yl)propan-1-amine (PubChem CID 83948751) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(3,5-diethylindol-1-yl)propan-1-amine.
| Compound Name | 3-(3,5-diethylindol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 83948751 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-(3,5-diethylindol-1-yl)propan-1-amine |
| SMILES | CCc1ccc2c(c1)c(CC)cn2CCCN |
| InChI | InChI=1S/C15H22N2/c1-3-12-6-7-15-14(10-12)13(4-2)11-17(15)9-5-8-16/h6-7,10-11H,3-5,8-9,16H2,1-2H3 |
| InChIKey | QVPLLQHSBBIJEL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |