C13H22N2 — CID 83945325
4-methyl-1-N-(3-methylphenyl)pentane-1,2-diamine (PubChem CID 83945325) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-methyl-1-N-(3-methylphenyl)pentane-1,2-diamine.
| Compound Name | 4-methyl-1-N-(3-methylphenyl)pentane-1,2-diamine |
|---|---|
| PubChem CID | 83945325 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 4-methyl-1-N-(3-methylphenyl)pentane-1,2-diamine |
| SMILES | Cc1cccc(NCC(N)CC(C)C)c1 |
| InChI | InChI=1S/C13H22N2/c1-10(2)7-12(14)9-15-13-6-4-5-11(3)8-13/h4-6,8,10,12,15H,7,9,14H2,1-3H3 |
| InChIKey | WBRWWFZIFYDCDU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |