C19H27NO2 — CID 83946264
3-butyl-1,5-di(propan-2-yl)indole-7-carboxylic acid (PubChem CID 83946264) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 3-butyl-1,5-di(propan-2-yl)indole-7-carboxylic acid.
| Compound Name | 3-butyl-1,5-di(propan-2-yl)indole-7-carboxylic acid |
|---|---|
| PubChem CID | 83946264 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 3-butyl-1,5-di(propan-2-yl)indole-7-carboxylic acid |
| SMILES | CCCCc1cn(C(C)C)c2c(C(=O)O)cc(C(C)C)cc12 |
| InChI | InChI=1S/C19H27NO2/c1-6-7-8-14-11-20(13(4)5)18-16(14)9-15(12(2)3)10-17(18)19(21)22/h9-13H,6-8H2,1-5H3,(H,21,22) |
| InChIKey | WOOLNOZKRNCRCR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |