2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid

C19H27NO2 — CID 83964639

IUPAC2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid
SMILESCc1c(C(C)C)c2cc(C(C)C)cc(C(=O)O)c2n1C(C)C
InChIInChI=1S/C19H27NO2/c1-10(2)14-8-15-17(11(3)4)13(7)20(12(5)6)18(15)16(9-14)19(21)22/h8-12H,1-7H3,(H,21,22)
InChIKeyMXTIMMNXQSDPHQ-UHFFFAOYSA-N
MW301.43 g/mol
LogP5.48
Rot. Bonds4

About 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid

2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid (PubChem CID 83964639) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid.

Molecular Properties

Compound Name2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid
PubChem CID83964639
Molecular FormulaC19H27NO2
Molecular Weight301.43 g/mol
Exact Mass301.20
IUPAC Name2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid
SMILESCc1c(C(C)C)c2cc(C(C)C)cc(C(=O)O)c2n1C(C)C
InChIInChI=1S/C19H27NO2/c1-10(2)14-8-15-17(11(3)4)13(7)20(12(5)6)18(15)16(9-14)19(21)22/h8-12H,1-7H3,(H,21,22)
InChIKeyMXTIMMNXQSDPHQ-UHFFFAOYSA-N
XLogP5.48
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500301.43
LogP ≤ 55.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid?
The IUPAC name of 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid (CID 83964639) is 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid.
What is the SMILES notation for 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid?
The canonical SMILES for 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid is Cc1c(C(C)C)c2cc(C(C)C)cc(C(=O)O)c2n1C(C)C.
What is the InChIKey of 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid?
The InChIKey is MXTIMMNXQSDPHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO2/c1-10(2)14-8-15-17(11(3)4)13(7)20(12(5)6)18(15)16(9-14)19(21)22/h8-12H,1-7H3,(H,21,22).
What are the key properties of 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid?
2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid has a molecular weight of 301.43 g/mol, XLogP of 5.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3,5-tri(propan-2-yl)indole-7-carboxylic acid is sourced from PubChem (CID 83964639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).