C19H25NO3 — CID 83947070
3-acetyl-5-tert-butyl-2-methyl-1-propylindole-7-carboxylic acid (PubChem CID 83947070) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 3-acetyl-5-tert-butyl-2-methyl-1-propylindole-7-carboxylic acid.
| Compound Name | 3-acetyl-5-tert-butyl-2-methyl-1-propylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 83947070 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 3-acetyl-5-tert-butyl-2-methyl-1-propylindole-7-carboxylic acid |
| SMILES | CCCn1c(C)c(C(C)=O)c2cc(C(C)(C)C)cc(C(=O)O)c21 |
| InChI | InChI=1S/C19H25NO3/c1-7-8-20-11(2)16(12(3)21)14-9-13(19(4,5)6)10-15(17(14)20)18(22)23/h9-10H,7-8H2,1-6H3,(H,22,23) |
| InChIKey | KCOULURCVLNQDO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |