C20H30N2O2 — CID 83963762
1-(3-aminopropyl)-5-tert-butyl-2-methyl-3-propylindole-7-carboxylic acid (PubChem CID 83963762) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-(3-aminopropyl)-5-tert-butyl-2-methyl-3-propylindole-7-carboxylic acid.
| Compound Name | 1-(3-aminopropyl)-5-tert-butyl-2-methyl-3-propylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 83963762 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-(3-aminopropyl)-5-tert-butyl-2-methyl-3-propylindole-7-carboxylic acid |
| SMILES | CCCc1c(C)n(CCCN)c2c(C(=O)O)cc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C20H30N2O2/c1-6-8-15-13(2)22(10-7-9-21)18-16(15)11-14(20(3,4)5)12-17(18)19(23)24/h11-12H,6-10,21H2,1-5H3,(H,23,24) |
| InChIKey | ILDSPTPOGWXWGO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|