C19H29N3O2 — CID 83945550
1,3-bis(3-aminopropyl)-5-tert-butylindole-7-carboxylic acid (PubChem CID 83945550) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1,3-bis(3-aminopropyl)-5-tert-butylindole-7-carboxylic acid.
| Compound Name | 1,3-bis(3-aminopropyl)-5-tert-butylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 83945550 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1,3-bis(3-aminopropyl)-5-tert-butylindole-7-carboxylic acid |
| SMILES | CC(C)(C)c1cc(C(=O)O)c2c(c1)c(CCCN)cn2CCCN |
| InChI | InChI=1S/C19H29N3O2/c1-19(2,3)14-10-15-13(6-4-7-20)12-22(9-5-8-21)17(15)16(11-14)18(23)24/h10-12H,4-9,20-21H2,1-3H3,(H,23,24) |
| InChIKey | JRZVRKOLBBPLTM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |