C19H28N2O2 — CID 83945547
1-(3-aminopropyl)-5-tert-butyl-3-propan-2-ylindole-7-carboxylic acid (PubChem CID 83945547) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-(3-aminopropyl)-5-tert-butyl-3-propan-2-ylindole-7-carboxylic acid.
| Compound Name | 1-(3-aminopropyl)-5-tert-butyl-3-propan-2-ylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 83945547 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-(3-aminopropyl)-5-tert-butyl-3-propan-2-ylindole-7-carboxylic acid |
| SMILES | CC(C)c1cn(CCCN)c2c(C(=O)O)cc(C(C)(C)C)cc12 |
| InChI | InChI=1S/C19H28N2O2/c1-12(2)16-11-21(8-6-7-20)17-14(16)9-13(19(3,4)5)10-15(17)18(22)23/h9-12H,6-8,20H2,1-5H3,(H,22,23) |
| InChIKey | CMWOSKVJIJCNPS-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |