C21H31NO2 — CID 83945621
1,3-dibutyl-7-tert-butylindole-5-carboxylic acid (PubChem CID 83945621) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 1,3-dibutyl-7-tert-butylindole-5-carboxylic acid.
| Compound Name | 1,3-dibutyl-7-tert-butylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 83945621 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 1,3-dibutyl-7-tert-butylindole-5-carboxylic acid |
| SMILES | CCCCc1cn(CCCC)c2c(C(C)(C)C)cc(C(=O)O)cc12 |
| InChI | InChI=1S/C21H31NO2/c1-6-8-10-15-14-22(11-9-7-2)19-17(15)12-16(20(23)24)13-18(19)21(3,4)5/h12-14H,6-11H2,1-5H3,(H,23,24) |
| InChIKey | OOVOIKXLTHWNIP-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |