C15H21N3O2 — CID 83945927
1,3-bis(2-aminoethyl)-7-ethylindole-5-carboxylic acid (PubChem CID 83945927) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1,3-bis(2-aminoethyl)-7-ethylindole-5-carboxylic acid.
| Compound Name | 1,3-bis(2-aminoethyl)-7-ethylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 83945927 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1,3-bis(2-aminoethyl)-7-ethylindole-5-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)cc2c(CCN)cn(CCN)c12 |
| InChI | InChI=1S/C15H21N3O2/c1-2-10-7-12(15(19)20)8-13-11(3-4-16)9-18(6-5-17)14(10)13/h7-9H,2-6,16-17H2,1H3,(H,19,20) |
| InChIKey | FEBSMGXKJBPROK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |