C17H24N2O2 — CID 83945572
3-(2-aminoethyl)-7-tert-butyl-1-ethylindole-5-carboxylic acid (PubChem CID 83945572) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(2-aminoethyl)-7-tert-butyl-1-ethylindole-5-carboxylic acid.
| Compound Name | 3-(2-aminoethyl)-7-tert-butyl-1-ethylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 83945572 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-(2-aminoethyl)-7-tert-butyl-1-ethylindole-5-carboxylic acid |
| SMILES | CCn1cc(CCN)c2cc(C(=O)O)cc(C(C)(C)C)c21 |
| InChI | InChI=1S/C17H24N2O2/c1-5-19-10-11(6-7-18)13-8-12(16(20)21)9-14(15(13)19)17(2,3)4/h8-10H,5-7,18H2,1-4H3,(H,20,21) |
| InChIKey | NBJAPEWEUITKEZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |