C18H25NO2 — CID 83945594
7-tert-butyl-3-ethyl-1-propylindole-5-carboxylic acid (PubChem CID 83945594) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 7-tert-butyl-3-ethyl-1-propylindole-5-carboxylic acid.
| Compound Name | 7-tert-butyl-3-ethyl-1-propylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 83945594 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 7-tert-butyl-3-ethyl-1-propylindole-5-carboxylic acid |
| SMILES | CCCn1cc(CC)c2cc(C(=O)O)cc(C(C)(C)C)c21 |
| InChI | InChI=1S/C18H25NO2/c1-6-8-19-11-12(7-2)14-9-13(17(20)21)10-15(16(14)19)18(3,4)5/h9-11H,6-8H2,1-5H3,(H,20,21) |
| InChIKey | WQFFPDIBVJPSDP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |