C18H27N3O2 — CID 83963865
1,3-bis(2-aminoethyl)-7-tert-butyl-2-methylindole-5-carboxylic acid (PubChem CID 83963865) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1,3-bis(2-aminoethyl)-7-tert-butyl-2-methylindole-5-carboxylic acid.
| Compound Name | 1,3-bis(2-aminoethyl)-7-tert-butyl-2-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 83963865 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1,3-bis(2-aminoethyl)-7-tert-butyl-2-methylindole-5-carboxylic acid |
| SMILES | Cc1c(CCN)c2cc(C(=O)O)cc(C(C)(C)C)c2n1CCN |
| InChI | InChI=1S/C18H27N3O2/c1-11-13(5-6-19)14-9-12(17(22)23)10-15(18(2,3)4)16(14)21(11)8-7-20/h9-10H,5-8,19-20H2,1-4H3,(H,22,23) |
| InChIKey | BZVQWZURUZMMDD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 94.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|