C16H22N2O2 — CID 83964376
1-(2-aminoethyl)-2,7-dimethyl-3-propan-2-ylindole-5-carboxylic acid (PubChem CID 83964376) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(2-aminoethyl)-2,7-dimethyl-3-propan-2-ylindole-5-carboxylic acid.
| Compound Name | 1-(2-aminoethyl)-2,7-dimethyl-3-propan-2-ylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 83964376 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(2-aminoethyl)-2,7-dimethyl-3-propan-2-ylindole-5-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)cc2c(C(C)C)c(C)n(CCN)c12 |
| InChI | InChI=1S/C16H22N2O2/c1-9(2)14-11(4)18(6-5-17)15-10(3)7-12(16(19)20)8-13(14)15/h7-9H,5-6,17H2,1-4H3,(H,19,20) |
| InChIKey | GWUFNDHDKBLGGR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|