C19H27NO3 — CID 83964145
1-(3-hydroxypropyl)-2-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid (PubChem CID 83964145) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-2-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid.
| Compound Name | 1-(3-hydroxypropyl)-2-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid |
|---|---|
| PubChem CID | 83964145 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 1-(3-hydroxypropyl)-2-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid |
| SMILES | Cc1c(C(C)C)c2cc(C(=O)O)cc(C(C)C)c2n1CCCO |
| InChI | InChI=1S/C19H27NO3/c1-11(2)15-9-14(19(22)23)10-16-17(12(3)4)13(5)20(18(15)16)7-6-8-21/h9-12,21H,6-8H2,1-5H3,(H,22,23) |
| InChIKey | BGAQYROOGMEUAA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|