C17H24N2O3 — CID 83964261
3-(2-aminoethyl)-7-ethyl-1-(3-hydroxypropyl)-2-methylindole-5-carboxylic acid (PubChem CID 83964261) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-(2-aminoethyl)-7-ethyl-1-(3-hydroxypropyl)-2-methylindole-5-carboxylic acid.
| Compound Name | 3-(2-aminoethyl)-7-ethyl-1-(3-hydroxypropyl)-2-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 83964261 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 3-(2-aminoethyl)-7-ethyl-1-(3-hydroxypropyl)-2-methylindole-5-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)cc2c(CCN)c(C)n(CCCO)c12 |
| InChI | InChI=1S/C17H24N2O3/c1-3-12-9-13(17(21)22)10-15-14(5-6-18)11(2)19(16(12)15)7-4-8-20/h9-10,20H,3-8,18H2,1-2H3,(H,21,22) |
| InChIKey | PHYBVVVAMNSDEC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|