C16H22N2O3 — CID 83964766
3-(2-aminoethyl)-1-(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid (PubChem CID 83964766) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1-(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid.
| Compound Name | 3-(2-aminoethyl)-1-(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 83964766 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 3-(2-aminoethyl)-1-(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid |
| SMILES | Cc1ccc2c(CCN)c(C)n(CCCO)c2c1C(=O)O |
| InChI | InChI=1S/C16H22N2O3/c1-10-4-5-13-12(6-7-17)11(2)18(8-3-9-19)15(13)14(10)16(20)21/h4-5,19H,3,6-9,17H2,1-2H3,(H,20,21) |
| InChIKey | JZLVKXKVOAXBTP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|