C16H21NO4 — CID 83964701
1-(2-hydroxyethyl)-3-(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid (PubChem CID 83964701) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid.
| Compound Name | 1-(2-hydroxyethyl)-3-(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 83964701 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid |
| SMILES | Cc1ccc2c(CCCO)c(C)n(CCO)c2c1C(=O)O |
| InChI | InChI=1S/C16H21NO4/c1-10-5-6-13-12(4-3-8-18)11(2)17(7-9-19)15(13)14(10)16(20)21/h5-6,18-19H,3-4,7-9H2,1-2H3,(H,20,21) |
| InChIKey | APVUAGRNGZYOLV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|