C17H23NO2 — CID 83964747
1-butyl-3-ethyl-2,6-dimethylindole-7-carboxylic acid (PubChem CID 83964747) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-butyl-3-ethyl-2,6-dimethylindole-7-carboxylic acid.
| Compound Name | 1-butyl-3-ethyl-2,6-dimethylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 83964747 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-butyl-3-ethyl-2,6-dimethylindole-7-carboxylic acid |
| SMILES | CCCCn1c(C)c(CC)c2ccc(C)c(C(=O)O)c21 |
| InChI | InChI=1S/C17H23NO2/c1-5-7-10-18-12(4)13(6-2)14-9-8-11(3)15(16(14)18)17(19)20/h8-9H,5-7,10H2,1-4H3,(H,19,20) |
| InChIKey | UQHXGXGOIIZGEK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|