C17H23NO4 — CID 83964764
1,3-bis(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid (PubChem CID 83964764) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 1,3-bis(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid.
| Compound Name | 1,3-bis(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid |
|---|---|
| PubChem CID | 83964764 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 1,3-bis(3-hydroxypropyl)-2,6-dimethylindole-7-carboxylic acid |
| SMILES | Cc1ccc2c(CCCO)c(C)n(CCCO)c2c1C(=O)O |
| InChI | InChI=1S/C17H23NO4/c1-11-6-7-14-13(5-3-9-19)12(2)18(8-4-10-20)16(14)15(11)17(21)22/h6-7,19-20H,3-5,8-10H2,1-2H3,(H,21,22) |
| InChIKey | ONOSRSJRFPAERU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|