1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid

C16H21NO2 — CID 83945763

IUPAC1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid
SMILESCC(C)c1cn(C)c2c(C(C)C)cc(C(=O)O)cc12
InChIInChI=1S/C16H21NO2/c1-9(2)12-6-11(16(18)19)7-13-14(10(3)4)8-17(5)15(12)13/h6-10H,1-5H3,(H,18,19)
InChIKeyYUYWZFUCYJODQH-UHFFFAOYSA-N
MW259.35 g/mol
LogP4.12
Rot. Bonds3

About 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid

1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid (PubChem CID 83945763) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid.

Molecular Properties

Compound Name1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid
PubChem CID83945763
Molecular FormulaC16H21NO2
Molecular Weight259.35 g/mol
Exact Mass259.16
IUPAC Name1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid
SMILESCC(C)c1cn(C)c2c(C(C)C)cc(C(=O)O)cc12
InChIInChI=1S/C16H21NO2/c1-9(2)12-6-11(16(18)19)7-13-14(10(3)4)8-17(5)15(12)13/h6-10H,1-5H3,(H,18,19)
InChIKeyYUYWZFUCYJODQH-UHFFFAOYSA-N
XLogP4.12
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.35
LogP ≤ 54.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid?
The IUPAC name of 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid (CID 83945763) is 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid.
What is the SMILES notation for 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid?
The canonical SMILES for 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid is CC(C)c1cn(C)c2c(C(C)C)cc(C(=O)O)cc12.
What is the InChIKey of 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid?
The InChIKey is YUYWZFUCYJODQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2/c1-9(2)12-6-11(16(18)19)7-13-14(10(3)4)8-17(5)15(12)13/h6-10H,1-5H3,(H,18,19).
What are the key properties of 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid?
1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid has a molecular weight of 259.35 g/mol, XLogP of 4.12, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,7-di(propan-2-yl)indole-5-carboxylic acid is sourced from PubChem (CID 83945763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).