7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid

C19H27NO2 — CID 83945610

IUPAC7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid
SMILESCC(C)c1cn(C(C)C)c2c(C(C)(C)C)cc(C(=O)O)cc12
InChIInChI=1S/C19H27NO2/c1-11(2)15-10-20(12(3)4)17-14(15)8-13(18(21)22)9-16(17)19(5,6)7/h8-12H,1-7H3,(H,21,22)
InChIKeyYVKWQSQKXOWWKQ-UHFFFAOYSA-N
MW301.43 g/mol
LogP5.34
Rot. Bonds3

About 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid

7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid (PubChem CID 83945610) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid.

Molecular Properties

Compound Name7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid
PubChem CID83945610
Molecular FormulaC19H27NO2
Molecular Weight301.43 g/mol
Exact Mass301.20
IUPAC Name7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid
SMILESCC(C)c1cn(C(C)C)c2c(C(C)(C)C)cc(C(=O)O)cc12
InChIInChI=1S/C19H27NO2/c1-11(2)15-10-20(12(3)4)17-14(15)8-13(18(21)22)9-16(17)19(5,6)7/h8-12H,1-7H3,(H,21,22)
InChIKeyYVKWQSQKXOWWKQ-UHFFFAOYSA-N
XLogP5.34
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500301.43
LogP ≤ 55.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid?
The IUPAC name of 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid (CID 83945610) is 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid.
What is the SMILES notation for 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid?
The canonical SMILES for 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid is CC(C)c1cn(C(C)C)c2c(C(C)(C)C)cc(C(=O)O)cc12.
What is the InChIKey of 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid?
The InChIKey is YVKWQSQKXOWWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO2/c1-11(2)15-10-20(12(3)4)17-14(15)8-13(18(21)22)9-16(17)19(5,6)7/h8-12H,1-7H3,(H,21,22).
What are the key properties of 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid?
7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid has a molecular weight of 301.43 g/mol, XLogP of 5.34, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-tert-butyl-1,3-di(propan-2-yl)indole-5-carboxylic acid is sourced from PubChem (CID 83945610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).