C18H25NO3 — CID 83945606
7-tert-butyl-3-(1-hydroxyethyl)-1-propan-2-ylindole-5-carboxylic acid (PubChem CID 83945606) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 7-tert-butyl-3-(1-hydroxyethyl)-1-propan-2-ylindole-5-carboxylic acid.
| Compound Name | 7-tert-butyl-3-(1-hydroxyethyl)-1-propan-2-ylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 83945606 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 7-tert-butyl-3-(1-hydroxyethyl)-1-propan-2-ylindole-5-carboxylic acid |
| SMILES | CC(O)c1cn(C(C)C)c2c(C(C)(C)C)cc(C(=O)O)cc12 |
| InChI | InChI=1S/C18H25NO3/c1-10(2)19-9-14(11(3)20)13-7-12(17(21)22)8-15(16(13)19)18(4,5)6/h7-11,20H,1-6H3,(H,21,22) |
| InChIKey | DHVLZSQXAXOASG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |