C12H15Cl2N3 — CID 83948501
2-[1-(2-aminoethyl)-6,7-dichloroindol-3-yl]ethanamine (PubChem CID 83948501) has the molecular formula C12H15Cl2N3 and a molecular weight of 272.18 g/mol. Its IUPAC name is 2-[1-(2-aminoethyl)-6,7-dichloroindol-3-yl]ethanamine.
| Compound Name | 2-[1-(2-aminoethyl)-6,7-dichloroindol-3-yl]ethanamine |
|---|---|
| PubChem CID | 83948501 |
| Molecular Formula | C12H15Cl2N3 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[1-(2-aminoethyl)-6,7-dichloroindol-3-yl]ethanamine |
| SMILES | NCCc1cn(CCN)c2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C12H15Cl2N3/c13-10-2-1-9-8(3-4-15)7-17(6-5-16)12(9)11(10)14/h1-2,7H,3-6,15-16H2 |
| InChIKey | PWHVHRURKFLJQY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |