C11H12Cl2N2 — CID 83948496
2-(6,7-dichloro-3-methylindol-1-yl)ethanamine (PubChem CID 83948496) has the molecular formula C11H12Cl2N2 and a molecular weight of 243.14 g/mol. Its IUPAC name is 2-(6,7-dichloro-3-methylindol-1-yl)ethanamine.
| Compound Name | 2-(6,7-dichloro-3-methylindol-1-yl)ethanamine |
|---|---|
| PubChem CID | 83948496 |
| Molecular Formula | C11H12Cl2N2 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-(6,7-dichloro-3-methylindol-1-yl)ethanamine |
| SMILES | Cc1cn(CCN)c2c(Cl)c(Cl)ccc12 |
| InChI | InChI=1S/C11H12Cl2N2/c1-7-6-15(5-4-14)11-8(7)2-3-9(12)10(11)13/h2-3,6H,4-5,14H2,1H3 |
| InChIKey | HZMAMFMYWSQYEN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |