C16H24N2 — CID 83948548
3-(4,7-dimethyl-3-propylindol-1-yl)propan-1-amine (PubChem CID 83948548) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-(4,7-dimethyl-3-propylindol-1-yl)propan-1-amine.
| Compound Name | 3-(4,7-dimethyl-3-propylindol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 83948548 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3-(4,7-dimethyl-3-propylindol-1-yl)propan-1-amine |
| SMILES | CCCc1cn(CCCN)c2c(C)ccc(C)c12 |
| InChI | InChI=1S/C16H24N2/c1-4-6-14-11-18(10-5-9-17)16-13(3)8-7-12(2)15(14)16/h7-8,11H,4-6,9-10,17H2,1-3H3 |
| InChIKey | BYEQUOZGJZQMJC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |