C15H22N2 — CID 83859861
3-(1,3,4,7-tetramethylindol-2-yl)propan-1-amine (PubChem CID 83859861) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3-(1,3,4,7-tetramethylindol-2-yl)propan-1-amine.
| Compound Name | 3-(1,3,4,7-tetramethylindol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 83859861 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3-(1,3,4,7-tetramethylindol-2-yl)propan-1-amine |
| SMILES | Cc1ccc(C)c2c1c(C)c(CCCN)n2C |
| InChI | InChI=1S/C15H22N2/c1-10-7-8-11(2)15-14(10)12(3)13(17(15)4)6-5-9-16/h7-8H,5-6,9,16H2,1-4H3 |
| InChIKey | VGTUZIGNNRUPPE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |